C23H33N3O2 — CID 166321688
2-(1-adamantyl)-N-[4-[2-(dimethylcarbamoylamino)ethyl]phenyl]acetamide (PubChem CID 166321688) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[4-[2-(dimethylcarbamoylamino)ethyl]phenyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[4-[2-(dimethylcarbamoylamino)ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 166321688 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 2-(1-adamantyl)-N-[4-[2-(dimethylcarbamoylamino)ethyl]phenyl]acetamide |
| SMILES | CN(C)C(=O)NCCc1ccc(NC(=O)CC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H33N3O2/c1-26(2)22(28)24-8-7-16-3-5-20(6-4-16)25-21(27)15-23-12-17-9-18(13-23)11-19(10-17)14-23/h3-6,17-19H,7-15H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | UPEWAOMAQMEIFG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |