C26H32N4O4 — CID 29367404
2-(1-adamantyl)-N-[2-[4-(furan-2-ylmethylcarbamoylamino)anilino]-2-oxoethyl]acetamide (PubChem CID 29367404) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-[4-(furan-2-ylmethylcarbamoylamino)anilino]-2-oxoethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-[4-(furan-2-ylmethylcarbamoylamino)anilino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 29367404 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-[4-(furan-2-ylmethylcarbamoylamino)anilino]-2-oxoethyl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCC(=O)Nc1ccc(NC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C26H32N4O4/c31-23(14-26-11-17-8-18(12-26)10-19(9-17)13-26)27-16-24(32)29-20-3-5-21(6-4-20)30-25(33)28-15-22-2-1-7-34-22/h1-7,17-19H,8-16H2,(H,27,31)(H,29,32)(H2,28,30,33) |
| InChIKey | HULSXDAFXGMDIR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |