C22H37N3O3 — CID 120888648
2-(1-adamantyl)-N-[2-[[4-(methoxymethyl)piperidin-4-yl]methylamino]-2-oxoethyl]acetamide (PubChem CID 120888648) has the molecular formula C22H37N3O3 and a molecular weight of 391.56 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-[[4-(methoxymethyl)piperidin-4-yl]methylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-[[4-(methoxymethyl)piperidin-4-yl]methylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 120888648 |
| Molecular Formula | C22H37N3O3 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-[[4-(methoxymethyl)piperidin-4-yl]methylamino]-2-oxoethyl]acetamide |
| SMILES | COCC1(CNC(=O)CNC(=O)CC23CC4CC(CC(C4)C2)C3)CCNCC1 |
| InChI | InChI=1S/C22H37N3O3/c1-28-15-21(2-4-23-5-3-21)14-25-20(27)13-24-19(26)12-22-9-16-6-17(10-22)8-18(7-16)11-22/h16-18,23H,2-15H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | APQZKLNUTMDHQQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |