C18H19F2NO3 — CID 171909746
N-(4,4-difluorocyclohexyl)-2-(7-methyl-2-oxochromen-4-yl)acetamide (PubChem CID 171909746) has the molecular formula C18H19F2NO3 and a molecular weight of 335.35 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2-(7-methyl-2-oxochromen-4-yl)acetamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-2-(7-methyl-2-oxochromen-4-yl)acetamide |
|---|---|
| PubChem CID | 171909746 |
| Molecular Formula | C18H19F2NO3 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2-(7-methyl-2-oxochromen-4-yl)acetamide |
| SMILES | Cc1ccc2c(CC(=O)NC3CCC(F)(F)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H19F2NO3/c1-11-2-3-14-12(10-17(23)24-15(14)8-11)9-16(22)21-13-4-6-18(19,20)7-5-13/h2-3,8,10,13H,4-7,9H2,1H3,(H,21,22) |
| InChIKey | POYQXMYQQUDMKC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|