C20H25N3O3 — CID 56749981
N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-2-(7-methyl-2-oxochromen-4-yl)acetamide (PubChem CID 56749981) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-2-(7-methyl-2-oxochromen-4-yl)acetamide.
| Compound Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-2-(7-methyl-2-oxochromen-4-yl)acetamide |
|---|---|
| PubChem CID | 56749981 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-2-(7-methyl-2-oxochromen-4-yl)acetamide |
| SMILES | Cc1ccc2c(CC(=O)N[C@H]3C[C@H]4CN(C)CCN4C3)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H25N3O3/c1-13-3-4-17-14(9-20(25)26-18(17)7-13)8-19(24)21-15-10-16-12-22(2)5-6-23(16)11-15/h3-4,7,9,15-16H,5-6,8,10-12H2,1-2H3,(H,21,24)/t15-,16-/m0/s1 |
| InChIKey | RHOYHWRIAZYNSK-HOTGVXAUSA-N |
| XLogP | 1.15 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|