C22H22N2O4 — CID 171910173
2-(7-methyl-2-oxochromen-4-yl)-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]acetamide (PubChem CID 171910173) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-(7-methyl-2-oxochromen-4-yl)-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]acetamide.
| Compound Name | 2-(7-methyl-2-oxochromen-4-yl)-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 171910173 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-(7-methyl-2-oxochromen-4-yl)-N-[(3S,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]acetamide |
| SMILES | Cc1ccc2c(CC(=O)N[C@@H]3COC[C@H]3Cc3ccncc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H22N2O4/c1-14-2-3-18-16(11-22(26)28-20(18)8-14)10-21(25)24-19-13-27-12-17(19)9-15-4-6-23-7-5-15/h2-8,11,17,19H,9-10,12-13H2,1H3,(H,24,25)/t17-,19-/m1/s1 |
| InChIKey | IMVIRBLMCGHLJI-IEBWSBKVSA-N |
| XLogP | 2.41 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|