C20H17ClN2O3 — CID 25148688
N-[(E)-(2-chlorophenyl)methylideneamino]-2-(5,8-dimethyl-2-oxochromen-4-yl)acetamide (PubChem CID 25148688) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is N-[(E)-(2-chlorophenyl)methylideneamino]-2-(5,8-dimethyl-2-oxochromen-4-yl)acetamide.
| Compound Name | N-[(E)-(2-chlorophenyl)methylideneamino]-2-(5,8-dimethyl-2-oxochromen-4-yl)acetamide |
|---|---|
| PubChem CID | 25148688 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[(E)-(2-chlorophenyl)methylideneamino]-2-(5,8-dimethyl-2-oxochromen-4-yl)acetamide |
| SMILES | Cc1ccc(C)c2c(CC(=O)N/N=C/c3ccccc3Cl)cc(=O)oc12 |
| InChI | InChI=1S/C20H17ClN2O3/c1-12-7-8-13(2)20-19(12)15(10-18(25)26-20)9-17(24)23-22-11-14-5-3-4-6-16(14)21/h3-8,10-11H,9H2,1-2H3,(H,23,24)/b22-11+ |
| InChIKey | CUDBXJOAULIOOA-SSDVNMTOSA-N |
| XLogP | 3.76 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|