C10H8ClN3O — CID 709280
N-[(2-chlorophenyl)methylideneamino]-2-cyanoacetamide (PubChem CID 709280) has the molecular formula C10H8ClN3O and a molecular weight of 221.65 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methylideneamino]-2-cyanoacetamide.
| Compound Name | N-[(2-chlorophenyl)methylideneamino]-2-cyanoacetamide |
|---|---|
| PubChem CID | 709280 |
| Molecular Formula | C10H8ClN3O |
| Molecular Weight | 221.65 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | N-[(2-chlorophenyl)methylideneamino]-2-cyanoacetamide |
| SMILES | N#CCC(=O)NN=Cc1ccccc1Cl |
| InChI | InChI=1S/C10H8ClN3O/c11-9-4-2-1-3-8(9)7-13-14-10(15)5-6-12/h1-4,7H,5H2,(H,14,15) |
| InChIKey | XDSPOYNCHBFWFL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.65 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|