C16H15ClIN3O — CID 3930729
N-[(2-chlorophenyl)methylideneamino]-2-(4-iodo-2-methylanilino)acetamide (PubChem CID 3930729) has the molecular formula C16H15ClIN3O and a molecular weight of 427.67 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methylideneamino]-2-(4-iodo-2-methylanilino)acetamide.
| Compound Name | N-[(2-chlorophenyl)methylideneamino]-2-(4-iodo-2-methylanilino)acetamide |
|---|---|
| PubChem CID | 3930729 |
| Molecular Formula | C16H15ClIN3O |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | N-[(2-chlorophenyl)methylideneamino]-2-(4-iodo-2-methylanilino)acetamide |
| SMILES | Cc1cc(I)ccc1NCC(=O)NN=Cc1ccccc1Cl |
| InChI | InChI=1S/C16H15ClIN3O/c1-11-8-13(18)6-7-15(11)19-10-16(22)21-20-9-12-4-2-3-5-14(12)17/h2-9,19H,10H2,1H3,(H,21,22) |
| InChIKey | IOVZHGDCYHACFG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|