C16H16IN3O3 — CID 3632618
N-[(2,4-dihydroxyphenyl)methylideneamino]-2-(4-iodo-2-methylanilino)acetamide (PubChem CID 3632618) has the molecular formula C16H16IN3O3 and a molecular weight of 425.23 g/mol. Its IUPAC name is N-[(2,4-dihydroxyphenyl)methylideneamino]-2-(4-iodo-2-methylanilino)acetamide.
| Compound Name | N-[(2,4-dihydroxyphenyl)methylideneamino]-2-(4-iodo-2-methylanilino)acetamide |
|---|---|
| PubChem CID | 3632618 |
| Molecular Formula | C16H16IN3O3 |
| Molecular Weight | 425.23 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | N-[(2,4-dihydroxyphenyl)methylideneamino]-2-(4-iodo-2-methylanilino)acetamide |
| SMILES | Cc1cc(I)ccc1NCC(=O)NN=Cc1ccc(O)cc1O |
| InChI | InChI=1S/C16H16IN3O3/c1-10-6-12(17)3-5-14(10)18-9-16(23)20-19-8-11-2-4-13(21)7-15(11)22/h2-8,18,21-22H,9H2,1H3,(H,20,23) |
| InChIKey | RUHMLJLVCDPBKO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|