C17H16IN3O3 — CID 3403757
N-(1,3-benzodioxol-5-ylmethylideneamino)-2-(4-iodo-2-methylanilino)acetamide (PubChem CID 3403757) has the molecular formula C17H16IN3O3 and a molecular weight of 437.24 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethylideneamino)-2-(4-iodo-2-methylanilino)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-2-(4-iodo-2-methylanilino)acetamide |
|---|---|
| PubChem CID | 3403757 |
| Molecular Formula | C17H16IN3O3 |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-2-(4-iodo-2-methylanilino)acetamide |
| SMILES | Cc1cc(I)ccc1NCC(=O)NN=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16IN3O3/c1-11-6-13(18)3-4-14(11)19-9-17(22)21-20-8-12-2-5-15-16(7-12)24-10-23-15/h2-8,19H,9-10H2,1H3,(H,21,22) |
| InChIKey | BGLSCUFXLSDCKQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|