C16H15Br2N3O3 — CID 3374779
2-(3,5-dibromo-4-methylanilino)-N-[(2,4-dihydroxyphenyl)methylideneamino]acetamide (PubChem CID 3374779) has the molecular formula C16H15Br2N3O3 and a molecular weight of 457.12 g/mol. Its IUPAC name is 2-(3,5-dibromo-4-methylanilino)-N-[(2,4-dihydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(3,5-dibromo-4-methylanilino)-N-[(2,4-dihydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3374779 |
| Molecular Formula | C16H15Br2N3O3 |
| Molecular Weight | 457.12 g/mol |
| Exact Mass | 454.95 |
| IUPAC Name | 2-(3,5-dibromo-4-methylanilino)-N-[(2,4-dihydroxyphenyl)methylideneamino]acetamide |
| SMILES | Cc1c(Br)cc(NCC(=O)NN=Cc2ccc(O)cc2O)cc1Br |
| InChI | InChI=1S/C16H15Br2N3O3/c1-9-13(17)4-11(5-14(9)18)19-8-16(24)21-20-7-10-2-3-12(22)6-15(10)23/h2-7,19,22-23H,8H2,1H3,(H,21,24) |
| InChIKey | SWLVGBVMIUBUEZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.12 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|