C15H12Cl2FN3O — CID 71699766
2-(2-chloro-3-fluoroanilino)-N-[(E)-(2-chlorophenyl)methylideneamino]acetamide (PubChem CID 71699766) has the molecular formula C15H12Cl2FN3O and a molecular weight of 340.19 g/mol. Its IUPAC name is 2-(2-chloro-3-fluoroanilino)-N-[(E)-(2-chlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-chloro-3-fluoroanilino)-N-[(E)-(2-chlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 71699766 |
| Molecular Formula | C15H12Cl2FN3O |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-(2-chloro-3-fluoroanilino)-N-[(E)-(2-chlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(CNc1cccc(F)c1Cl)N/N=C/c1ccccc1Cl |
| InChI | InChI=1S/C15H12Cl2FN3O/c16-11-5-2-1-4-10(11)8-20-21-14(22)9-19-13-7-3-6-12(18)15(13)17/h1-8,19H,9H2,(H,21,22)/b20-8+ |
| InChIKey | HGWFRRPDGLMRNV-DNTJNYDQSA-N |
| XLogP | 3.69 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|