C22H22F3NO4 — CID 112800294
4-[[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]methyl]-6,7-dimethylchromen-2-one (PubChem CID 112800294) has the molecular formula C22H22F3NO4 and a molecular weight of 421.42 g/mol. Its IUPAC name is 4-[[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 112800294 |
| Molecular Formula | C22H22F3NO4 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 4-[[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]methyl]-6,7-dimethylchromen-2-one |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NCc1cc(=O)oc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C22H22F3NO4/c1-13-8-17-15(10-21(27)30-20(17)9-14(13)2)12-26-18-11-16(22(23,24)25)4-5-19(18)29-7-6-28-3/h4-5,8-11,26H,6-7,12H2,1-3H3 |
| InChIKey | OVGYUUWOKZJQAI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|