C26H29NO6S — CID 42969585
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 42969585) has the molecular formula C26H29NO6S and a molecular weight of 483.59 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 42969585 |
| Molecular Formula | C26H29NO6S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl 2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | COCCNC(=O)CSc1ccccc1C(=O)OCc1cc(=O)oc2cc(C)c(C(C)C)cc12 |
| InChI | InChI=1S/C26H29NO6S/c1-16(2)20-13-21-18(12-25(29)33-22(21)11-17(20)3)14-32-26(30)19-7-5-6-8-23(19)34-15-24(28)27-9-10-31-4/h5-8,11-13,16H,9-10,14-15H2,1-4H3,(H,27,28) |
| InChIKey | WVIVZCKWHXVTNV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|