C21H23N3OS — CID 35501492
N-(2-methyl-6-propan-2-ylphenyl)-2-(3-methylquinoxalin-2-yl)sulfanylacetamide (PubChem CID 35501492) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is N-(2-methyl-6-propan-2-ylphenyl)-2-(3-methylquinoxalin-2-yl)sulfanylacetamide.
| Compound Name | N-(2-methyl-6-propan-2-ylphenyl)-2-(3-methylquinoxalin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 35501492 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-(2-methyl-6-propan-2-ylphenyl)-2-(3-methylquinoxalin-2-yl)sulfanylacetamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)CSc1nc2ccccc2nc1C |
| InChI | InChI=1S/C21H23N3OS/c1-13(2)16-9-7-8-14(3)20(16)24-19(25)12-26-21-15(4)22-17-10-5-6-11-18(17)23-21/h5-11,13H,12H2,1-4H3,(H,24,25) |
| InChIKey | ZJXVDUFUFAYSKV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |