C17H19ClN2OS — CID 46693728
2-[(3-chloro-2-pyridinyl)sulfanyl]-N-(2-methyl-6-propan-2-ylphenyl)acetamide (PubChem CID 46693728) has the molecular formula C17H19ClN2OS and a molecular weight of 334.87 g/mol. Its IUPAC name is 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-(2-methyl-6-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 46693728 |
| Molecular Formula | C17H19ClN2OS |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)CSc1ncccc1Cl |
| InChI | InChI=1S/C17H19ClN2OS/c1-11(2)13-7-4-6-12(3)16(13)20-15(21)10-22-17-14(18)8-5-9-19-17/h4-9,11H,10H2,1-3H3,(H,20,21) |
| InChIKey | AXFAAYOVNUOHIW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |