C20H17N3O2S2 — CID 41099497
N-[(1R)-1-(furan-2-yl)ethyl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide (PubChem CID 41099497) has the molecular formula C20H17N3O2S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)ethyl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-[(1R)-1-(furan-2-yl)ethyl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 41099497 |
| Molecular Formula | C20H17N3O2S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)ethyl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide |
| SMILES | C[C@@H](NC(=O)CSc1nc(-c2cccs2)nc2ccccc12)c1ccco1 |
| InChI | InChI=1S/C20H17N3O2S2/c1-13(16-8-4-10-25-16)21-18(24)12-27-20-14-6-2-3-7-15(14)22-19(23-20)17-9-5-11-26-17/h2-11,13H,12H2,1H3,(H,21,24)/t13-/m1/s1 |
| InChIKey | UHUKMCYHQLNFOC-CYBMUJFWSA-N |
| XLogP | 4.92 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |