C22H20N4O4S2 — CID 16581465
2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-N-[1-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 16581465) has the molecular formula C22H20N4O4S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-N-[1-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-N-[1-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 16581465 |
| Molecular Formula | C22H20N4O4S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-N-[1-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CSc1nc(-c2ccco2)nc2ccccc12)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C22H20N4O4S2/c1-14(15-8-10-16(11-9-15)32(23,28)29)24-20(27)13-31-22-17-5-2-3-6-18(17)25-21(26-22)19-7-4-12-30-19/h2-12,14H,13H2,1H3,(H,24,27)(H2,23,28,29) |
| InChIKey | BNINKCVFVPNQGN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |