C22H19N3O2S2 — CID 16507527
N-(2-methoxy-5-methylphenyl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide (PubChem CID 16507527) has the molecular formula C22H19N3O2S2 and a molecular weight of 421.55 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 16507527 |
| Molecular Formula | C22H19N3O2S2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CSc1nc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C22H19N3O2S2/c1-14-9-10-18(27-2)17(12-14)23-20(26)13-29-22-15-6-3-4-7-16(15)24-21(25-22)19-8-5-11-28-19/h3-12H,13H2,1-2H3,(H,23,26) |
| InChIKey | DQQSVSQQAYEVJX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |