C18H11F6N3OS — CID 60545390
N-[2-(trifluoromethyl)phenyl]-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylacetamide (PubChem CID 60545390) has the molecular formula C18H11F6N3OS and a molecular weight of 431.36 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)phenyl]-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylacetamide.
| Compound Name | N-[2-(trifluoromethyl)phenyl]-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 60545390 |
| Molecular Formula | C18H11F6N3OS |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | N-[2-(trifluoromethyl)phenyl]-2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nc(C(F)(F)F)nc2ccccc12)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H11F6N3OS/c19-17(20,21)11-6-2-4-8-13(11)25-14(28)9-29-15-10-5-1-3-7-12(10)26-16(27-15)18(22,23)24/h1-8H,9H2,(H,25,28) |
| InChIKey | JRTRTNFEYUWVDS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |