C20H20FN3OS — CID 1442417
2-(2-tert-butylquinazolin-4-yl)sulfanyl-N-(2-fluorophenyl)acetamide (PubChem CID 1442417) has the molecular formula C20H20FN3OS and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-(2-tert-butylquinazolin-4-yl)sulfanyl-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-(2-tert-butylquinazolin-4-yl)sulfanyl-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 1442417 |
| Molecular Formula | C20H20FN3OS |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-(2-tert-butylquinazolin-4-yl)sulfanyl-N-(2-fluorophenyl)acetamide |
| SMILES | CC(C)(C)c1nc(SCC(=O)Nc2ccccc2F)c2ccccc2n1 |
| InChI | InChI=1S/C20H20FN3OS/c1-20(2,3)19-23-15-10-6-4-8-13(15)18(24-19)26-12-17(25)22-16-11-7-5-9-14(16)21/h4-11H,12H2,1-3H3,(H,22,25) |
| InChIKey | QNVUDNWRUAPMLD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |