C18H15N3O2S2 — CID 7606641
1-[2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetyl]pyrrolidin-2-one (PubChem CID 7606641) has the molecular formula C18H15N3O2S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-[2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetyl]pyrrolidin-2-one.
| Compound Name | 1-[2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 7606641 |
| Molecular Formula | C18H15N3O2S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 1-[2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylacetyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C(=O)CSc1nc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C18H15N3O2S2/c22-15-8-3-9-21(15)16(23)11-25-18-12-5-1-2-6-13(12)19-17(20-18)14-7-4-10-24-14/h1-2,4-7,10H,3,8-9,11H2 |
| InChIKey | ALUPSAZQCFZVTQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |