C20H21N3OS2 — CID 4786666
1-(4-methylpiperidin-1-yl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylethanone (PubChem CID 4786666) has the molecular formula C20H21N3OS2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylethanone.
| Compound Name | 1-(4-methylpiperidin-1-yl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylethanone |
|---|---|
| PubChem CID | 4786666 |
| Molecular Formula | C20H21N3OS2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylethanone |
| SMILES | CC1CCN(C(=O)CSc2nc(-c3cccs3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C20H21N3OS2/c1-14-8-10-23(11-9-14)18(24)13-26-20-15-5-2-3-6-16(15)21-19(22-20)17-7-4-12-25-17/h2-7,12,14H,8-11,13H2,1H3 |
| InChIKey | LRLJHVAJVBBERO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |