C18H19N3S2 — CID 166179640
4-(2-pyrrolidin-1-ylethylsulfanyl)-2-thiophen-2-ylquinazoline (PubChem CID 166179640) has the molecular formula C18H19N3S2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 4-(2-pyrrolidin-1-ylethylsulfanyl)-2-thiophen-2-ylquinazoline.
| Compound Name | 4-(2-pyrrolidin-1-ylethylsulfanyl)-2-thiophen-2-ylquinazoline |
|---|---|
| PubChem CID | 166179640 |
| Molecular Formula | C18H19N3S2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 4-(2-pyrrolidin-1-ylethylsulfanyl)-2-thiophen-2-ylquinazoline |
| SMILES | c1csc(-c2nc(SCCN3CCCC3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C18H19N3S2/c1-2-7-15-14(6-1)18(23-13-11-21-9-3-4-10-21)20-17(19-15)16-8-5-12-22-16/h1-2,5-8,12H,3-4,9-11,13H2 |
| InChIKey | HVTWNMIUMHWZCZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |