C24H21FN4OS2 — CID 16507524
1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylethanone (PubChem CID 16507524) has the molecular formula C24H21FN4OS2 and a molecular weight of 464.59 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylethanone.
| Compound Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylethanone |
|---|---|
| PubChem CID | 16507524 |
| Molecular Formula | C24H21FN4OS2 |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylethanone |
| SMILES | O=C(CSc1nc(-c2cccs2)nc2ccccc12)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H21FN4OS2/c25-17-7-9-18(10-8-17)28-11-13-29(14-12-28)22(30)16-32-24-19-4-1-2-5-20(19)26-23(27-24)21-6-3-15-31-21/h1-10,15H,11-14,16H2 |
| InChIKey | FXPOBRMNBPHXFH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |