C24H21FN4O2S — CID 24585532
1-[4-(2-fluorophenyl)piperazin-1-yl]-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanylethanone (PubChem CID 24585532) has the molecular formula C24H21FN4O2S and a molecular weight of 448.52 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanylethanone.
| Compound Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanylethanone |
|---|---|
| PubChem CID | 24585532 |
| Molecular Formula | C24H21FN4O2S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanylethanone |
| SMILES | O=C(CSc1nc(-c2ccco2)nc2ccccc12)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H21FN4O2S/c25-18-7-2-4-9-20(18)28-11-13-29(14-12-28)22(30)16-32-24-17-6-1-3-8-19(17)26-23(27-24)21-10-5-15-31-21/h1-10,15H,11-14,16H2 |
| InChIKey | XUSNBSPILSQLMT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |