C24H24N4O2S — CID 24585518
N-[[4-(dimethylamino)phenyl]methyl]-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-N-methylacetamide (PubChem CID 24585518) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-N-methylacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 24585518 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-N-methylacetamide |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)CSc1nc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C24H24N4O2S/c1-27(2)18-12-10-17(11-13-18)15-28(3)22(29)16-31-24-19-7-4-5-8-20(19)25-23(26-24)21-9-6-14-30-21/h4-14H,15-16H2,1-3H3 |
| InChIKey | SDGLOEQIQOXLIY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|