C23H18N4O2S — CID 46687618
N-(2-cyanoethyl)-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-N-phenylacetamide (PubChem CID 46687618) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-N-phenylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 46687618 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-(2-cyanoethyl)-2-[2-(furan-2-yl)quinazolin-4-yl]sulfanyl-N-phenylacetamide |
| SMILES | N#CCCN(C(=O)CSc1nc(-c2ccco2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C23H18N4O2S/c24-13-7-14-27(17-8-2-1-3-9-17)21(28)16-30-23-18-10-4-5-11-19(18)25-22(26-23)20-12-6-15-29-20/h1-6,8-12,15H,7,14,16H2 |
| InChIKey | MCMOBPFYOLLZKW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 83.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |