C24H22N4O3S — CID 55490415
3-[benzyl-[2-[2-(furan-2-yl)quinazolin-4-yl]sulfanylacetyl]amino]propanamide (PubChem CID 55490415) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 3-[benzyl-[2-[2-(furan-2-yl)quinazolin-4-yl]sulfanylacetyl]amino]propanamide.
| Compound Name | 3-[benzyl-[2-[2-(furan-2-yl)quinazolin-4-yl]sulfanylacetyl]amino]propanamide |
|---|---|
| PubChem CID | 55490415 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3-[benzyl-[2-[2-(furan-2-yl)quinazolin-4-yl]sulfanylacetyl]amino]propanamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)C(=O)CSc1nc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C24H22N4O3S/c25-21(29)12-13-28(15-17-7-2-1-3-8-17)22(30)16-32-24-18-9-4-5-10-19(18)26-23(27-24)20-11-6-14-31-20/h1-11,14H,12-13,15-16H2,(H2,25,29) |
| InChIKey | GTGWZFZXAJSRMD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |