C25H19FN4OS — CID 6409017
N-(2-cyanoethyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanyl-N-phenylacetamide (PubChem CID 6409017) has the molecular formula C25H19FN4OS and a molecular weight of 442.52 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanyl-N-phenylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 6409017 |
| Molecular Formula | C25H19FN4OS |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-(2-cyanoethyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanyl-N-phenylacetamide |
| SMILES | N#CCCN(C(=O)CSc1nnc(-c2ccc(F)cc2)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C25H19FN4OS/c26-19-13-11-18(12-14-19)24-21-9-4-5-10-22(21)25(29-28-24)32-17-23(31)30(16-6-15-27)20-7-2-1-3-8-20/h1-5,7-14H,6,16-17H2 |
| InChIKey | XFMZCADOFRXLOQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |