C21H18FN3OS — CID 2161058
N-(2-cyanoethyl)-N-(4-fluorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide (PubChem CID 2161058) has the molecular formula C21H18FN3OS and a molecular weight of 379.46 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(4-fluorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2-cyanoethyl)-N-(4-fluorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 2161058 |
| Molecular Formula | C21H18FN3OS |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-(2-cyanoethyl)-N-(4-fluorophenyl)-2-(4-methylquinolin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)N(CCC#N)c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C21H18FN3OS/c1-15-13-20(24-19-6-3-2-5-18(15)19)27-14-21(26)25(12-4-11-23)17-9-7-16(22)8-10-17/h2-3,5-10,13H,4,12,14H2,1H3 |
| InChIKey | FYUHSKFLMOMOBQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |