C25H21FN4O2S — CID 24527121
3-(N-[2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetyl]anilino)propanamide (PubChem CID 24527121) has the molecular formula C25H21FN4O2S and a molecular weight of 460.53 g/mol. Its IUPAC name is 3-(N-[2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetyl]anilino)propanamide.
| Compound Name | 3-(N-[2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetyl]anilino)propanamide |
|---|---|
| PubChem CID | 24527121 |
| Molecular Formula | C25H21FN4O2S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 3-(N-[2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetyl]anilino)propanamide |
| SMILES | NC(=O)CCN(C(=O)CSc1nnc(-c2ccc(F)cc2)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C25H21FN4O2S/c26-18-12-10-17(11-13-18)24-20-8-4-5-9-21(20)25(29-28-24)33-16-23(32)30(15-14-22(27)31)19-6-2-1-3-7-19/h1-13H,14-16H2,(H2,27,31) |
| InChIKey | WBXDINSRHWTRQX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |