C24H20FN3OS — CID 8023932
2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanyl-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 8023932) has the molecular formula C24H20FN3OS and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanyl-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanyl-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 8023932 |
| Molecular Formula | C24H20FN3OS |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanyl-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CSc1nnc(-c2ccc(F)cc2)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H20FN3OS/c1-16(17-7-3-2-4-8-17)26-22(29)15-30-24-21-10-6-5-9-20(21)23(27-28-24)18-11-13-19(25)14-12-18/h2-14,16H,15H2,1H3,(H,26,29)/t16-/m1/s1 |
| InChIKey | CBBCDWKFNJCAQQ-MRXNPFEDSA-N |
| XLogP | 5.41 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |