C26H26FN3OS — CID 3942658
N-(1-adamantyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide (PubChem CID 3942658) has the molecular formula C26H26FN3OS and a molecular weight of 447.58 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide.
| Compound Name | N-(1-adamantyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 3942658 |
| Molecular Formula | C26H26FN3OS |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-(1-adamantyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(F)cc2)c2ccccc12)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H26FN3OS/c27-20-7-5-19(6-8-20)24-21-3-1-2-4-22(21)25(30-29-24)32-15-23(31)28-26-12-16-9-17(13-26)11-18(10-16)14-26/h1-8,16-18H,9-15H2,(H,28,31) |
| InChIKey | BGKLZHVRBAKEHG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |