C17H19FN2OS2 — CID 4292802
1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(thiophen-2-ylmethylsulfanyl)ethanone (PubChem CID 4292802) has the molecular formula C17H19FN2OS2 and a molecular weight of 350.48 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(thiophen-2-ylmethylsulfanyl)ethanone.
| Compound Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(thiophen-2-ylmethylsulfanyl)ethanone |
|---|---|
| PubChem CID | 4292802 |
| Molecular Formula | C17H19FN2OS2 |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(thiophen-2-ylmethylsulfanyl)ethanone |
| SMILES | O=C(CSCc1cccs1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H19FN2OS2/c18-14-3-5-15(6-4-14)19-7-9-20(10-8-19)17(21)13-22-12-16-2-1-11-23-16/h1-6,11H,7-10,12-13H2 |
| InChIKey | RAVTZVVMSTYLIS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |