C19H22FN3O2S2 — CID 9020375
N-(3-fluorophenyl)-2-[4-[2-(thiophen-2-ylmethylsulfanyl)acetyl]piperazin-1-yl]acetamide (PubChem CID 9020375) has the molecular formula C19H22FN3O2S2 and a molecular weight of 407.54 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[4-[2-(thiophen-2-ylmethylsulfanyl)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[4-[2-(thiophen-2-ylmethylsulfanyl)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9020375 |
| Molecular Formula | C19H22FN3O2S2 |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-(3-fluorophenyl)-2-[4-[2-(thiophen-2-ylmethylsulfanyl)acetyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)CSCc2cccs2)CC1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H22FN3O2S2/c20-15-3-1-4-16(11-15)21-18(24)12-22-6-8-23(9-7-22)19(25)14-26-13-17-5-2-10-27-17/h1-5,10-11H,6-9,12-14H2,(H,21,24) |
| InChIKey | VESQJGRAMDAIBJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |