C20H24FN3OS — CID 17424096
1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone (PubChem CID 17424096) has the molecular formula C20H24FN3OS and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 17424096 |
| Molecular Formula | C20H24FN3OS |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-(2-thiophen-2-ylpyrrolidin-1-yl)ethanone |
| SMILES | O=C(CN1CCCC1c1cccs1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H24FN3OS/c21-16-5-7-17(8-6-16)22-10-12-23(13-11-22)20(25)15-24-9-1-3-18(24)19-4-2-14-26-19/h2,4-8,14,18H,1,3,9-13,15H2 |
| InChIKey | SFVLFHUPBLBCDD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |