C23H28FN3O — CID 51339468
2-[2-(4-fluorophenyl)pyrrolidin-1-yl]-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone (PubChem CID 51339468) has the molecular formula C23H28FN3O and a molecular weight of 381.50 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)pyrrolidin-1-yl]-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[2-(4-fluorophenyl)pyrrolidin-1-yl]-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 51339468 |
| Molecular Formula | C23H28FN3O |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-[2-(4-fluorophenyl)pyrrolidin-1-yl]-1-[4-(3-methylphenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cccc(N2CCN(C(=O)CN3CCCC3c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C23H28FN3O/c1-18-4-2-5-21(16-18)25-12-14-26(15-13-25)23(28)17-27-11-3-6-22(27)19-7-9-20(24)10-8-19/h2,4-5,7-10,16,22H,3,6,11-15,17H2,1H3 |
| InChIKey | RAUHZVYPCYDVSM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |