C20H21N3O2S2 — CID 9268004
(2S)-N-[[(2R)-oxolan-2-yl]methyl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylpropanamide (PubChem CID 9268004) has the molecular formula C20H21N3O2S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is (2S)-N-[[(2R)-oxolan-2-yl]methyl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-[[(2R)-oxolan-2-yl]methyl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 9268004 |
| Molecular Formula | C20H21N3O2S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (2S)-N-[[(2R)-oxolan-2-yl]methyl]-2-(2-thiophen-2-ylquinazolin-4-yl)sulfanylpropanamide |
| SMILES | C[C@H](Sc1nc(-c2cccs2)nc2ccccc12)C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C20H21N3O2S2/c1-13(19(24)21-12-14-6-4-10-25-14)27-20-15-7-2-3-8-16(15)22-18(23-20)17-9-5-11-26-17/h2-3,5,7-9,11,13-14H,4,6,10,12H2,1H3,(H,21,24)/t13-,14+/m0/s1 |
| InChIKey | GPMXXERPVNETOS-UONOGXRCSA-N |
| XLogP | 4.13 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |