C18H24N4O2S — CID 41176307
(2R)-2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]propanamide (PubChem CID 41176307) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is (2R)-2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]propanamide.
| Compound Name | (2R)-2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 41176307 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (2R)-2-[4-(ethylamino)quinazolin-2-yl]sulfanyl-N-[[(2S)-oxolan-2-yl]methyl]propanamide |
| SMILES | CCNc1nc(S[C@H](C)C(=O)NC[C@@H]2CCCO2)nc2ccccc12 |
| InChI | InChI=1S/C18H24N4O2S/c1-3-19-16-14-8-4-5-9-15(14)21-18(22-16)25-12(2)17(23)20-11-13-7-6-10-24-13/h4-5,8-9,12-13H,3,6-7,10-11H2,1-2H3,(H,20,23)(H,19,21,22)/t12-,13+/m1/s1 |
| InChIKey | UWYUWHSAFRXFRY-OLZOCXBDSA-N |
| XLogP | 2.84 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |