About S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate
S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate (PubChem CID 11431948) has the molecular formula C19H18BrN3OS
and a molecular weight of 416.34 g/mol. Its IUPAC name is S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate.
Molecular Properties
| Compound Name | S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate |
| PubChem CID | 11431948 |
| Molecular Formula | C19H18BrN3OS |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate |
| SMILES | CC(C)/N=C(/Nc1c2ccccc2nc2ccccc12)SC(=O)CBr |
| InChI | InChI=1S/C19H18BrN3OS/c1-12(2)21-19(25-17(24)11-20)23-18-13-7-3-5-9-15(13)22-16-10-6-4-8-14(16)18/h3-10,12H,11H2,1-2H3,(H,21,22,23) |
| InChIKey | JSNMXNHHDHZGMQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate?
The IUPAC name of S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate (CID 11431948) is S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate.
What is the SMILES notation for S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate?
The canonical SMILES for S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate is CC(C)/N=C(/Nc1c2ccccc2nc2ccccc12)SC(=O)CBr.
What is the InChIKey of S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate?
The InChIKey is JSNMXNHHDHZGMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18BrN3OS/c1-12(2)21-19(25-17(24)11-20)23-18-13-7-3-5-9-15(13)22-16-10-6-4-8-14(16)18/h3-10,12H,11H2,1-2H3,(H,21,22,23).
What are the key properties of S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate?
S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate has a molecular weight of 416.34 g/mol, XLogP of 5.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(N-acridin-9-yl-N'-propan-2-ylcarbamimidoyl) 2-bromoethanethioate is sourced from PubChem (CID 11431948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).