C12H10N4O6 — CID 141043528
[2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid (PubChem CID 141043528) has the molecular formula C12H10N4O6 and a molecular weight of 306.23 g/mol. Its IUPAC name is [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid.
| Compound Name | [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 141043528 |
| Molecular Formula | C12H10N4O6 |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid |
| SMILES | O=C(O)Nc1nc2ccccc2c(NC(=O)O)c1NC(=O)O |
| InChI | InChI=1S/C12H10N4O6/c17-10(18)14-7-5-3-1-2-4-6(5)13-9(16-12(21)22)8(7)15-11(19)20/h1-4,15H,(H,17,18)(H,19,20)(H,21,22)(H2,13,14,16) |
| InChIKey | SKAGDOIJZXZSDL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |