[2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid

C12H10N4O6 — CID 141043528

IUPAC[2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid
SMILESO=C(O)Nc1nc2ccccc2c(NC(=O)O)c1NC(=O)O
InChIInChI=1S/C12H10N4O6/c17-10(18)14-7-5-3-1-2-4-6(5)13-9(16-12(21)22)8(7)15-11(19)20/h1-4,15H,(H,17,18)(H,19,20)(H,21,22)(H2,13,14,16)
InChIKeySKAGDOIJZXZSDL-UHFFFAOYSA-N
MW306.23 g/mol
LogP2.50
Rot. Bonds3

About [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid

[2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid (PubChem CID 141043528) has the molecular formula C12H10N4O6 and a molecular weight of 306.23 g/mol. Its IUPAC name is [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid.

Molecular Properties

Compound Name[2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid
PubChem CID141043528
Molecular FormulaC12H10N4O6
Molecular Weight306.23 g/mol
Exact Mass306.06
IUPAC Name[2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid
SMILESO=C(O)Nc1nc2ccccc2c(NC(=O)O)c1NC(=O)O
InChIInChI=1S/C12H10N4O6/c17-10(18)14-7-5-3-1-2-4-6(5)13-9(16-12(21)22)8(7)15-11(19)20/h1-4,15H,(H,17,18)(H,19,20)(H,21,22)(H2,13,14,16)
InChIKeySKAGDOIJZXZSDL-UHFFFAOYSA-N
XLogP2.50
TPSA160.88 Ų
H-Bond Donors6
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500306.23
LogP ≤ 52.50
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 104

Analyze [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid?
The IUPAC name of [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid (CID 141043528) is [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid.
What is the SMILES notation for [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid?
The canonical SMILES for [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid is O=C(O)Nc1nc2ccccc2c(NC(=O)O)c1NC(=O)O.
What is the InChIKey of [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid?
The InChIKey is SKAGDOIJZXZSDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O6/c17-10(18)14-7-5-3-1-2-4-6(5)13-9(16-12(21)22)8(7)15-11(19)20/h1-4,15H,(H,17,18)(H,19,20)(H,21,22)(H2,13,14,16).
What are the key properties of [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid?
[2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid has a molecular weight of 306.23 g/mol, XLogP of 2.50, 3 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(carboxyamino)quinolin-4-yl]carbamic acid is sourced from PubChem (CID 141043528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).