About S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate
S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate (PubChem CID 11387216) has the molecular formula C23H18BrN3OS
and a molecular weight of 464.39 g/mol. Its IUPAC name is S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate.
Molecular Properties
| Compound Name | S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate |
| PubChem CID | 11387216 |
| Molecular Formula | C23H18BrN3OS |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate |
| SMILES | O=C(CBr)S/C(=N\Cc1ccccc1)Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C23H18BrN3OS/c24-14-21(28)29-23(25-15-16-8-2-1-3-9-16)27-22-17-10-4-6-12-19(17)26-20-13-7-5-11-18(20)22/h1-13H,14-15H2,(H,25,26,27) |
| InChIKey | CJNDAUAWVWIFKZ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate?
The IUPAC name of S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate (CID 11387216) is S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate.
What is the SMILES notation for S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate?
The canonical SMILES for S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate is O=C(CBr)S/C(=N\Cc1ccccc1)Nc1c2ccccc2nc2ccccc12.
What is the InChIKey of S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate?
The InChIKey is CJNDAUAWVWIFKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18BrN3OS/c24-14-21(28)29-23(25-15-16-8-2-1-3-9-16)27-22-17-10-4-6-12-19(17)26-20-13-7-5-11-18(20)22/h1-13H,14-15H2,(H,25,26,27).
What are the key properties of S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate?
S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate has a molecular weight of 464.39 g/mol, XLogP of 6.01, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(N-acridin-9-yl-N'-benzylcarbamimidoyl) 2-bromoethanethioate is sourced from PubChem (CID 11387216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).