C29H28N2O4 — CID 58748832
3-phenyl-2-[[4-[4-(3-pyrrol-1-ylpropoxy)phenyl]benzoyl]amino]propanoic acid (PubChem CID 58748832) has the molecular formula C29H28N2O4 and a molecular weight of 468.55 g/mol. Its IUPAC name is 3-phenyl-2-[[4-[4-(3-pyrrol-1-ylpropoxy)phenyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-phenyl-2-[[4-[4-(3-pyrrol-1-ylpropoxy)phenyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58748832 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 3-phenyl-2-[[4-[4-(3-pyrrol-1-ylpropoxy)phenyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)c1ccc(-c2ccc(OCCCn3cccc3)cc2)cc1 |
| InChI | InChI=1S/C29H28N2O4/c32-28(30-27(29(33)34)21-22-7-2-1-3-8-22)25-11-9-23(10-12-25)24-13-15-26(16-14-24)35-20-6-19-31-17-4-5-18-31/h1-5,7-18,27H,6,19-21H2,(H,30,32)(H,33,34) |
| InChIKey | BRPHPKJLGGJHPM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|