C20H25ClO — CID 21281297
5-(4-chlorobutoxy)-2-(2,6-dimethylphenyl)-1,3-dimethylbenzene (PubChem CID 21281297) has the molecular formula C20H25ClO and a molecular weight of 316.87 g/mol. Its IUPAC name is 5-(4-chlorobutoxy)-2-(2,6-dimethylphenyl)-1,3-dimethylbenzene.
| Compound Name | 5-(4-chlorobutoxy)-2-(2,6-dimethylphenyl)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 21281297 |
| Molecular Formula | C20H25ClO |
| Molecular Weight | 316.87 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 5-(4-chlorobutoxy)-2-(2,6-dimethylphenyl)-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1-c1c(C)cc(OCCCCCl)cc1C |
| InChI | InChI=1S/C20H25ClO/c1-14-8-7-9-15(2)19(14)20-16(3)12-18(13-17(20)4)22-11-6-5-10-21/h7-9,12-13H,5-6,10-11H2,1-4H3 |
| InChIKey | OLBMPVAFKBLTJB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.87 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|