C22H31NO — CID 21281226
7-[3,5-dimethyl-4-(2-methylphenyl)phenoxy]heptan-1-amine (PubChem CID 21281226) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 7-[3,5-dimethyl-4-(2-methylphenyl)phenoxy]heptan-1-amine.
| Compound Name | 7-[3,5-dimethyl-4-(2-methylphenyl)phenoxy]heptan-1-amine |
|---|---|
| PubChem CID | 21281226 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 7-[3,5-dimethyl-4-(2-methylphenyl)phenoxy]heptan-1-amine |
| SMILES | Cc1ccccc1-c1c(C)cc(OCCCCCCCN)cc1C |
| InChI | InChI=1S/C22H31NO/c1-17-11-7-8-12-21(17)22-18(2)15-20(16-19(22)3)24-14-10-6-4-5-9-13-23/h7-8,11-12,15-16H,4-6,9-10,13-14,23H2,1-3H3 |
| InChIKey | YWQUMMGOBGCIEV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|