C16H20N2O4S — CID 7600690
2-[3-(azepan-1-yl)-3-oxopropyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 7600690) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 2-[3-(azepan-1-yl)-3-oxopropyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[3-(azepan-1-yl)-3-oxopropyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 7600690 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[3-(azepan-1-yl)-3-oxopropyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C(CCN1C(=O)c2ccccc2S1(=O)=O)N1CCCCCC1 |
| InChI | InChI=1S/C16H20N2O4S/c19-15(17-10-5-1-2-6-11-17)9-12-18-16(20)13-7-3-4-8-14(13)23(18,21)22/h3-4,7-8H,1-2,5-6,9-12H2 |
| InChIKey | ZFADTNHVBPLOLO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |