C22H30N2O4S — CID 44922130
N,N-dicyclohexyl-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanamide (PubChem CID 44922130) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is N,N-dicyclohexyl-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanamide.
| Compound Name | N,N-dicyclohexyl-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 44922130 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N,N-dicyclohexyl-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2S1(=O)=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H30N2O4S/c25-21(24(17-9-3-1-4-10-17)18-11-5-2-6-12-18)15-16-23-22(26)19-13-7-8-14-20(19)29(23,27)28/h7-8,13-14,17-18H,1-6,9-12,15-16H2 |
| InChIKey | GHBQNVYKJUENFH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |