C15H19NO3S2 — CID 9289919
2-(2-cyclohexylsulfanylethyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 9289919) has the molecular formula C15H19NO3S2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-(2-cyclohexylsulfanylethyl)-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-(2-cyclohexylsulfanylethyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 9289919 |
| Molecular Formula | C15H19NO3S2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-(2-cyclohexylsulfanylethyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CCSC1CCCCC1 |
| InChI | InChI=1S/C15H19NO3S2/c17-15-13-8-4-5-9-14(13)21(18,19)16(15)10-11-20-12-6-2-1-3-7-12/h4-5,8-9,12H,1-3,6-7,10-11H2 |
| InChIKey | YQOXSPDZXLYUQN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |